C24H22N4O5S2 — CID 17176222
(E)-N-[[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]-3-(3-nitrophenyl)prop-2-enamide (PubChem CID 17176222) has the molecular formula C24H22N4O5S2 and a molecular weight of 510.60 g/mol. Its IUPAC name is (E)-N-[[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]-3-(3-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]-3-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 17176222 |
| Molecular Formula | C24H22N4O5S2 |
| Molecular Weight | 510.60 g/mol |
| Exact Mass | 510.10 |
| IUPAC Name | (E)-N-[[4-[(2,4-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]-3-(3-nitrophenyl)prop-2-enamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(NC(=S)NC(=O)/C=C/c3cccc([N+](=O)[O-])c3)cc2)c(C)c1 |
| InChI | InChI=1S/C24H22N4O5S2/c1-16-6-12-22(17(2)14-16)27-35(32,33)21-10-8-19(9-11-21)25-24(34)26-23(29)13-7-18-4-3-5-20(15-18)28(30)31/h3-15,27H,1-2H3,(H2,25,26,29,34)/b13-7+ |
| InChIKey | AZUHTFKPYHWWGQ-NTUHNPAUSA-N |
| XLogP | 4.54 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.60 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|