C18H21N3O4S2 — CID 4932985
2-methoxy-N-[[4-(propylsulfamoyl)phenyl]carbamothioyl]benzamide (PubChem CID 4932985) has the molecular formula C18H21N3O4S2 and a molecular weight of 407.52 g/mol. Its IUPAC name is 2-methoxy-N-[[4-(propylsulfamoyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 2-methoxy-N-[[4-(propylsulfamoyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4932985 |
| Molecular Formula | C18H21N3O4S2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | 2-methoxy-N-[[4-(propylsulfamoyl)phenyl]carbamothioyl]benzamide |
| SMILES | CCCNS(=O)(=O)c1ccc(NC(=S)NC(=O)c2ccccc2OC)cc1 |
| InChI | InChI=1S/C18H21N3O4S2/c1-3-12-19-27(23,24)14-10-8-13(9-11-14)20-18(26)21-17(22)15-6-4-5-7-16(15)25-2/h4-11,19H,3,12H2,1-2H3,(H2,20,21,22,26) |
| InChIKey | NVACYXSIMBTRQR-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|