C22H20FN3O3S2 — CID 4950344
2-fluoro-N-[[4-(2-phenylethylsulfamoyl)phenyl]carbamothioyl]benzamide (PubChem CID 4950344) has the molecular formula C22H20FN3O3S2 and a molecular weight of 457.55 g/mol. Its IUPAC name is 2-fluoro-N-[[4-(2-phenylethylsulfamoyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 2-fluoro-N-[[4-(2-phenylethylsulfamoyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4950344 |
| Molecular Formula | C22H20FN3O3S2 |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | 2-fluoro-N-[[4-(2-phenylethylsulfamoyl)phenyl]carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1ccc(S(=O)(=O)NCCc2ccccc2)cc1)c1ccccc1F |
| InChI | InChI=1S/C22H20FN3O3S2/c23-20-9-5-4-8-19(20)21(27)26-22(30)25-17-10-12-18(13-11-17)31(28,29)24-15-14-16-6-2-1-3-7-16/h1-13,24H,14-15H2,(H2,25,26,27,30) |
| InChIKey | YXYHKRQMZKFCBC-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|