C26H29N3O4S2 — CID 17141479
4-butan-2-yloxy-N-[[4-(2-phenylethylsulfamoyl)phenyl]carbamothioyl]benzamide (PubChem CID 17141479) has the molecular formula C26H29N3O4S2 and a molecular weight of 511.67 g/mol. Its IUPAC name is 4-butan-2-yloxy-N-[[4-(2-phenylethylsulfamoyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 4-butan-2-yloxy-N-[[4-(2-phenylethylsulfamoyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17141479 |
| Molecular Formula | C26H29N3O4S2 |
| Molecular Weight | 511.67 g/mol |
| Exact Mass | 511.16 |
| IUPAC Name | 4-butan-2-yloxy-N-[[4-(2-phenylethylsulfamoyl)phenyl]carbamothioyl]benzamide |
| SMILES | CCC(C)Oc1ccc(C(=O)NC(=S)Nc2ccc(S(=O)(=O)NCCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C26H29N3O4S2/c1-3-19(2)33-23-13-9-21(10-14-23)25(30)29-26(34)28-22-11-15-24(16-12-22)35(31,32)27-18-17-20-7-5-4-6-8-20/h4-16,19,27H,3,17-18H2,1-2H3,(H2,28,29,30,34) |
| InChIKey | AHUJAMJHZKJHCY-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.67 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|