C24H24N4O2S — CID 17141680
4-butan-2-yloxy-N-[(4-phenyldiazenylphenyl)carbamothioyl]benzamide (PubChem CID 17141680) has the molecular formula C24H24N4O2S and a molecular weight of 432.55 g/mol. Its IUPAC name is 4-butan-2-yloxy-N-[(4-phenyldiazenylphenyl)carbamothioyl]benzamide.
| Compound Name | 4-butan-2-yloxy-N-[(4-phenyldiazenylphenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17141680 |
| Molecular Formula | C24H24N4O2S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 4-butan-2-yloxy-N-[(4-phenyldiazenylphenyl)carbamothioyl]benzamide |
| SMILES | CCC(C)Oc1ccc(C(=O)NC(=S)Nc2ccc(/N=N/c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C24H24N4O2S/c1-3-17(2)30-22-15-9-18(10-16-22)23(29)26-24(31)25-19-11-13-21(14-12-19)28-27-20-7-5-4-6-8-20/h4-17H,3H2,1-2H3,(H2,25,26,29,31)/b28-27+ |
| InChIKey | HBGNSFKKFQGNGQ-BYYHNAKLSA-N |
| XLogP | 6.41 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|