C19H19N2O4S- — CID 7278917
2-[[4-[(2S)-butan-2-yl]oxybenzoyl]carbamothioylamino]benzoate (PubChem CID 7278917) has the molecular formula C19H19N2O4S- and a molecular weight of 371.44 g/mol. Its IUPAC name is 2-[[4-[(2S)-butan-2-yl]oxybenzoyl]carbamothioylamino]benzoate.
| Compound Name | 2-[[4-[(2S)-butan-2-yl]oxybenzoyl]carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 7278917 |
| Molecular Formula | C19H19N2O4S- |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 2-[[4-[(2S)-butan-2-yl]oxybenzoyl]carbamothioylamino]benzoate |
| SMILES | CC[C@H](C)Oc1ccc(C(=O)NC(=S)Nc2ccccc2C(=O)[O-])cc1 |
| InChI | InChI=1S/C19H20N2O4S/c1-3-12(2)25-14-10-8-13(9-11-14)17(22)21-19(26)20-16-7-5-4-6-15(16)18(23)24/h4-12H,3H2,1-2H3,(H,23,24)(H2,20,21,22,26)/p-1/t12-/m0/s1 |
| InChIKey | MEKJCJOZRBFCMJ-LBPRGKRZSA-M |
| XLogP | 2.35 |
| TPSA | 90.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|