C15H10FN2O3S- — CID 7316472
4-[(2-fluorobenzoyl)carbamothioylamino]benzoate (PubChem CID 7316472) has the molecular formula C15H10FN2O3S- and a molecular weight of 317.32 g/mol. Its IUPAC name is 4-[(2-fluorobenzoyl)carbamothioylamino]benzoate.
| Compound Name | 4-[(2-fluorobenzoyl)carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 7316472 |
| Molecular Formula | C15H10FN2O3S- |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 4-[(2-fluorobenzoyl)carbamothioylamino]benzoate |
| SMILES | O=C([O-])c1ccc(NC(=S)NC(=O)c2ccccc2F)cc1 |
| InChI | InChI=1S/C15H11FN2O3S/c16-12-4-2-1-3-11(12)13(19)18-15(22)17-10-7-5-9(6-8-10)14(20)21/h1-8H,(H,20,21)(H2,17,18,19,22)/p-1 |
| InChIKey | XTKGBJBLNQACMW-UHFFFAOYSA-M |
| XLogP | 1.32 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|