C19H19FN4O3S — CID 4950508
N-[[[4-(butanoylamino)benzoyl]amino]carbamothioyl]-2-fluorobenzamide (PubChem CID 4950508) has the molecular formula C19H19FN4O3S and a molecular weight of 402.45 g/mol. Its IUPAC name is N-[[[4-(butanoylamino)benzoyl]amino]carbamothioyl]-2-fluorobenzamide.
| Compound Name | N-[[[4-(butanoylamino)benzoyl]amino]carbamothioyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 4950508 |
| Molecular Formula | C19H19FN4O3S |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | N-[[[4-(butanoylamino)benzoyl]amino]carbamothioyl]-2-fluorobenzamide |
| SMILES | CCCC(=O)Nc1ccc(C(=O)NNC(=S)NC(=O)c2ccccc2F)cc1 |
| InChI | InChI=1S/C19H19FN4O3S/c1-2-5-16(25)21-13-10-8-12(9-11-13)17(26)23-24-19(28)22-18(27)14-6-3-4-7-15(14)20/h3-4,6-11H,2,5H2,1H3,(H,21,25)(H,23,26)(H2,22,24,27,28) |
| InChIKey | NMMHXHZWJAVMGE-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|