C18H18BrN3O3 — CID 1011742
N-[4-[[(2-bromobenzoyl)amino]carbamoyl]phenyl]butanamide (PubChem CID 1011742) has the molecular formula C18H18BrN3O3 and a molecular weight of 404.26 g/mol. Its IUPAC name is N-[4-[[(2-bromobenzoyl)amino]carbamoyl]phenyl]butanamide.
| Compound Name | N-[4-[[(2-bromobenzoyl)amino]carbamoyl]phenyl]butanamide |
|---|---|
| PubChem CID | 1011742 |
| Molecular Formula | C18H18BrN3O3 |
| Molecular Weight | 404.26 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | N-[4-[[(2-bromobenzoyl)amino]carbamoyl]phenyl]butanamide |
| SMILES | CCCC(=O)Nc1ccc(C(=O)NNC(=O)c2ccccc2Br)cc1 |
| InChI | InChI=1S/C18H18BrN3O3/c1-2-5-16(23)20-13-10-8-12(9-11-13)17(24)21-22-18(25)14-6-3-4-7-15(14)19/h3-4,6-11H,2,5H2,1H3,(H,20,23)(H,21,24)(H,22,25) |
| InChIKey | JZDUXOQRHNZBIN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.26 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|