C18H19ClN4O3 — CID 4922849
N-[4-[[(3-chlorophenyl)carbamoylamino]carbamoyl]phenyl]butanamide (PubChem CID 4922849) has the molecular formula C18H19ClN4O3 and a molecular weight of 374.83 g/mol. Its IUPAC name is N-[4-[[(3-chlorophenyl)carbamoylamino]carbamoyl]phenyl]butanamide.
| Compound Name | N-[4-[[(3-chlorophenyl)carbamoylamino]carbamoyl]phenyl]butanamide |
|---|---|
| PubChem CID | 4922849 |
| Molecular Formula | C18H19ClN4O3 |
| Molecular Weight | 374.83 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | N-[4-[[(3-chlorophenyl)carbamoylamino]carbamoyl]phenyl]butanamide |
| SMILES | CCCC(=O)Nc1ccc(C(=O)NNC(=O)Nc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C18H19ClN4O3/c1-2-4-16(24)20-14-9-7-12(8-10-14)17(25)22-23-18(26)21-15-6-3-5-13(19)11-15/h3,5-11H,2,4H2,1H3,(H,20,24)(H,22,25)(H2,21,23,26) |
| InChIKey | JAWBYEVBRPXHOR-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.83 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|