C10H12ClN3O3 — CID 5227471
ethyl N-[(3-chlorophenyl)carbamoylamino]carbamate (PubChem CID 5227471) has the molecular formula C10H12ClN3O3 and a molecular weight of 257.68 g/mol. Its IUPAC name is ethyl N-[(3-chlorophenyl)carbamoylamino]carbamate.
| Compound Name | ethyl N-[(3-chlorophenyl)carbamoylamino]carbamate |
|---|---|
| PubChem CID | 5227471 |
| Molecular Formula | C10H12ClN3O3 |
| Molecular Weight | 257.68 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | ethyl N-[(3-chlorophenyl)carbamoylamino]carbamate |
| SMILES | CCOC(=O)NNC(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C10H12ClN3O3/c1-2-17-10(16)14-13-9(15)12-8-5-3-4-7(11)6-8/h3-6H,2H2,1H3,(H,14,16)(H2,12,13,15) |
| InChIKey | CUQPCLOMWDYMHP-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.68 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|