C15H22N6O6 — CID 15610264
ethyl N-[[3-[(ethoxycarbonylamino)carbamoylamino]-4-methylphenyl]carbamoylamino]carbamate (PubChem CID 15610264) has the molecular formula C15H22N6O6 and a molecular weight of 382.38 g/mol. Its IUPAC name is ethyl N-[[3-[(ethoxycarbonylamino)carbamoylamino]-4-methylphenyl]carbamoylamino]carbamate.
| Compound Name | ethyl N-[[3-[(ethoxycarbonylamino)carbamoylamino]-4-methylphenyl]carbamoylamino]carbamate |
|---|---|
| PubChem CID | 15610264 |
| Molecular Formula | C15H22N6O6 |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | ethyl N-[[3-[(ethoxycarbonylamino)carbamoylamino]-4-methylphenyl]carbamoylamino]carbamate |
| SMILES | CCOC(=O)NNC(=O)Nc1ccc(C)c(NC(=O)NNC(=O)OCC)c1 |
| InChI | InChI=1S/C15H22N6O6/c1-4-26-14(24)20-18-12(22)16-10-7-6-9(3)11(8-10)17-13(23)19-21-15(25)27-5-2/h6-8H,4-5H2,1-3H3,(H,20,24)(H,21,25)(H2,16,18,22)(H2,17,19,23) |
| InChIKey | PNWDVNLDGKBBCD-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 158.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|