C10H15N5O2 — CID 123491202
1-amino-3-[4-methyl-3-(methylcarbamoylamino)phenyl]urea (PubChem CID 123491202) has the molecular formula C10H15N5O2 and a molecular weight of 237.26 g/mol. Its IUPAC name is 1-amino-3-[4-methyl-3-(methylcarbamoylamino)phenyl]urea.
| Compound Name | 1-amino-3-[4-methyl-3-(methylcarbamoylamino)phenyl]urea |
|---|---|
| PubChem CID | 123491202 |
| Molecular Formula | C10H15N5O2 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 1-amino-3-[4-methyl-3-(methylcarbamoylamino)phenyl]urea |
| SMILES | CNC(=O)Nc1cc(NC(=O)NN)ccc1C |
| InChI | InChI=1S/C10H15N5O2/c1-6-3-4-7(13-10(17)15-11)5-8(6)14-9(16)12-2/h3-5H,11H2,1-2H3,(H2,12,14,16)(H2,13,15,17) |
| InChIKey | CMRZOSNWHQABBO-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 108.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|