C16H17ClN4O2 — CID 39186247
2-amino-N-[3-[(4-chlorophenyl)carbamoylamino]-4-methylphenyl]acetamide (PubChem CID 39186247) has the molecular formula C16H17ClN4O2 and a molecular weight of 332.79 g/mol. Its IUPAC name is 2-amino-N-[3-[(4-chlorophenyl)carbamoylamino]-4-methylphenyl]acetamide.
| Compound Name | 2-amino-N-[3-[(4-chlorophenyl)carbamoylamino]-4-methylphenyl]acetamide |
|---|---|
| PubChem CID | 39186247 |
| Molecular Formula | C16H17ClN4O2 |
| Molecular Weight | 332.79 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 2-amino-N-[3-[(4-chlorophenyl)carbamoylamino]-4-methylphenyl]acetamide |
| SMILES | Cc1ccc(NC(=O)CN)cc1NC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H17ClN4O2/c1-10-2-5-13(19-15(22)9-18)8-14(10)21-16(23)20-12-6-3-11(17)4-7-12/h2-8H,9,18H2,1H3,(H,19,22)(H2,20,21,23) |
| InChIKey | QIYUPSWCCBJGRK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.79 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |