C9H12IN3O — CID 146654172
2-amino-N-[3-(iodoamino)-4-methylphenyl]acetamide (PubChem CID 146654172) has the molecular formula C9H12IN3O and a molecular weight of 305.12 g/mol. Its IUPAC name is 2-amino-N-[3-(iodoamino)-4-methylphenyl]acetamide.
| Compound Name | 2-amino-N-[3-(iodoamino)-4-methylphenyl]acetamide |
|---|---|
| PubChem CID | 146654172 |
| Molecular Formula | C9H12IN3O |
| Molecular Weight | 305.12 g/mol |
| Exact Mass | 305.00 |
| IUPAC Name | 2-amino-N-[3-(iodoamino)-4-methylphenyl]acetamide |
| SMILES | Cc1ccc(NC(=O)CN)cc1NI |
| InChI | InChI=1S/C9H12IN3O/c1-6-2-3-7(4-8(6)13-10)12-9(14)5-11/h2-4,13H,5,11H2,1H3,(H,12,14) |
| InChIKey | VPGWZYRPPCGYCQ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.12 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|