C13H14N2O — CID 115151559
2-amino-N-(6-methylnaphthalen-2-yl)acetamide (PubChem CID 115151559) has the molecular formula C13H14N2O and a molecular weight of 214.27 g/mol. Its IUPAC name is 2-amino-N-(6-methylnaphthalen-2-yl)acetamide.
| Compound Name | 2-amino-N-(6-methylnaphthalen-2-yl)acetamide |
|---|---|
| PubChem CID | 115151559 |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 2-amino-N-(6-methylnaphthalen-2-yl)acetamide |
| SMILES | Cc1ccc2cc(NC(=O)CN)ccc2c1 |
| InChI | InChI=1S/C13H14N2O/c1-9-2-3-11-7-12(15-13(16)8-14)5-4-10(11)6-9/h2-7H,8,14H2,1H3,(H,15,16) |
| InChIKey | FGTAUCROIHBAGV-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |