C27H24Cl2N4OS2 — CID 144610213
1,3-bis[3-(4-chloroanilino)sulfanyl-4-methylphenyl]urea (PubChem CID 144610213) has the molecular formula C27H24Cl2N4OS2 and a molecular weight of 555.56 g/mol. Its IUPAC name is 1,3-bis[3-(4-chloroanilino)sulfanyl-4-methylphenyl]urea.
| Compound Name | 1,3-bis[3-(4-chloroanilino)sulfanyl-4-methylphenyl]urea |
|---|---|
| PubChem CID | 144610213 |
| Molecular Formula | C27H24Cl2N4OS2 |
| Molecular Weight | 555.56 g/mol |
| Exact Mass | 554.08 |
| IUPAC Name | 1,3-bis[3-(4-chloroanilino)sulfanyl-4-methylphenyl]urea |
| SMILES | Cc1ccc(NC(=O)Nc2ccc(C)c(SNc3ccc(Cl)cc3)c2)cc1SNc1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H24Cl2N4OS2/c1-17-3-9-23(15-25(17)35-32-21-11-5-19(28)6-12-21)30-27(34)31-24-10-4-18(2)26(16-24)36-33-22-13-7-20(29)8-14-22/h3-16,32-33H,1-2H3,(H2,30,31,34) |
| InChIKey | OJLDAINGQJMIFJ-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.56 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|