C15H12Cl2N2O3 — CID 84514488
methyl 2-chloro-5-[(4-chlorophenyl)carbamoylamino]benzoate (PubChem CID 84514488) has the molecular formula C15H12Cl2N2O3 and a molecular weight of 339.18 g/mol. Its IUPAC name is methyl 2-chloro-5-[(4-chlorophenyl)carbamoylamino]benzoate.
| Compound Name | methyl 2-chloro-5-[(4-chlorophenyl)carbamoylamino]benzoate |
|---|---|
| PubChem CID | 84514488 |
| Molecular Formula | C15H12Cl2N2O3 |
| Molecular Weight | 339.18 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | methyl 2-chloro-5-[(4-chlorophenyl)carbamoylamino]benzoate |
| SMILES | COC(=O)c1cc(NC(=O)Nc2ccc(Cl)cc2)ccc1Cl |
| InChI | InChI=1S/C15H12Cl2N2O3/c1-22-14(20)12-8-11(6-7-13(12)17)19-15(21)18-10-4-2-9(16)3-5-10/h2-8H,1H3,(H2,18,19,21) |
| InChIKey | OTAQLVGBGUXOPR-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.18 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |