C17H22ClN3O4 — CID 72889670
methyl 5-[(1-carbamoylcycloheptyl)carbamoylamino]-2-chlorobenzoate (PubChem CID 72889670) has the molecular formula C17H22ClN3O4 and a molecular weight of 367.83 g/mol. Its IUPAC name is methyl 5-[(1-carbamoylcycloheptyl)carbamoylamino]-2-chlorobenzoate.
| Compound Name | methyl 5-[(1-carbamoylcycloheptyl)carbamoylamino]-2-chlorobenzoate |
|---|---|
| PubChem CID | 72889670 |
| Molecular Formula | C17H22ClN3O4 |
| Molecular Weight | 367.83 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | methyl 5-[(1-carbamoylcycloheptyl)carbamoylamino]-2-chlorobenzoate |
| SMILES | COC(=O)c1cc(NC(=O)NC2(C(N)=O)CCCCCC2)ccc1Cl |
| InChI | InChI=1S/C17H22ClN3O4/c1-25-14(22)12-10-11(6-7-13(12)18)20-16(24)21-17(15(19)23)8-4-2-3-5-9-17/h6-7,10H,2-5,8-9H2,1H3,(H2,19,23)(H2,20,21,24) |
| InChIKey | XAESEDVUXKBWKC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.83 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |