C18H22ClNO5 — CID 56807913
2-[1-[2-(4-chloro-3-methoxycarbonylanilino)-2-oxoethyl]cyclohexyl]acetic acid (PubChem CID 56807913) has the molecular formula C18H22ClNO5 and a molecular weight of 367.83 g/mol. Its IUPAC name is 2-[1-[2-(4-chloro-3-methoxycarbonylanilino)-2-oxoethyl]cyclohexyl]acetic acid.
| Compound Name | 2-[1-[2-(4-chloro-3-methoxycarbonylanilino)-2-oxoethyl]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 56807913 |
| Molecular Formula | C18H22ClNO5 |
| Molecular Weight | 367.83 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 2-[1-[2-(4-chloro-3-methoxycarbonylanilino)-2-oxoethyl]cyclohexyl]acetic acid |
| SMILES | COC(=O)c1cc(NC(=O)CC2(CC(=O)O)CCCCC2)ccc1Cl |
| InChI | InChI=1S/C18H22ClNO5/c1-25-17(24)13-9-12(5-6-14(13)19)20-15(21)10-18(11-16(22)23)7-3-2-4-8-18/h5-6,9H,2-4,7-8,10-11H2,1H3,(H,20,21)(H,22,23) |
| InChIKey | HSKSPLIGBVGNSE-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.83 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |