C16H17ClF3NO3 — CID 51037570
2-[1-[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl]cyclopentyl]acetic acid (PubChem CID 51037570) has the molecular formula C16H17ClF3NO3 and a molecular weight of 363.76 g/mol. Its IUPAC name is 2-[1-[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl]cyclopentyl]acetic acid.
| Compound Name | 2-[1-[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl]cyclopentyl]acetic acid |
|---|---|
| PubChem CID | 51037570 |
| Molecular Formula | C16H17ClF3NO3 |
| Molecular Weight | 363.76 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 2-[1-[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl]cyclopentyl]acetic acid |
| SMILES | O=C(O)CC1(CC(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)CCCC1 |
| InChI | InChI=1S/C16H17ClF3NO3/c17-12-4-3-10(7-11(12)16(18,19)20)21-13(22)8-15(9-14(23)24)5-1-2-6-15/h3-4,7H,1-2,5-6,8-9H2,(H,21,22)(H,23,24) |
| InChIKey | FNLDSTXXVHURIQ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.76 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |