C17H20Cl2N2O4 — CID 31617015
2-[1-[2-[2-(2,5-dichlorobenzoyl)hydrazinyl]-2-oxoethyl]cyclohexyl]acetic acid (PubChem CID 31617015) has the molecular formula C17H20Cl2N2O4 and a molecular weight of 387.26 g/mol. Its IUPAC name is 2-[1-[2-[2-(2,5-dichlorobenzoyl)hydrazinyl]-2-oxoethyl]cyclohexyl]acetic acid.
| Compound Name | 2-[1-[2-[2-(2,5-dichlorobenzoyl)hydrazinyl]-2-oxoethyl]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 31617015 |
| Molecular Formula | C17H20Cl2N2O4 |
| Molecular Weight | 387.26 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | 2-[1-[2-[2-(2,5-dichlorobenzoyl)hydrazinyl]-2-oxoethyl]cyclohexyl]acetic acid |
| SMILES | O=C(O)CC1(CC(=O)NNC(=O)c2cc(Cl)ccc2Cl)CCCCC1 |
| InChI | InChI=1S/C17H20Cl2N2O4/c18-11-4-5-13(19)12(8-11)16(25)21-20-14(22)9-17(10-15(23)24)6-2-1-3-7-17/h4-5,8H,1-3,6-7,9-10H2,(H,20,22)(H,21,25)(H,23,24) |
| InChIKey | GKUYSQRXCYHEHM-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.26 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|