C16H18Cl2O3 — CID 63496419
2-[1-[2-(2,4-dichlorophenyl)-2-oxoethyl]cyclohexyl]acetic acid (PubChem CID 63496419) has the molecular formula C16H18Cl2O3 and a molecular weight of 329.22 g/mol. Its IUPAC name is 2-[1-[2-(2,4-dichlorophenyl)-2-oxoethyl]cyclohexyl]acetic acid.
| Compound Name | 2-[1-[2-(2,4-dichlorophenyl)-2-oxoethyl]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 63496419 |
| Molecular Formula | C16H18Cl2O3 |
| Molecular Weight | 329.22 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 2-[1-[2-(2,4-dichlorophenyl)-2-oxoethyl]cyclohexyl]acetic acid |
| SMILES | O=C(O)CC1(CC(=O)c2ccc(Cl)cc2Cl)CCCCC1 |
| InChI | InChI=1S/C16H18Cl2O3/c17-11-4-5-12(13(18)8-11)14(19)9-16(10-15(20)21)6-2-1-3-7-16/h4-5,8H,1-3,6-7,9-10H2,(H,20,21) |
| InChIKey | YPBQYSRWLLIECD-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.22 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |