2-[1-[2-(2,4-dichlorophenyl)-2-oxoethyl]cyclohexyl]acetic acid

C16H18Cl2O3 — CID 63496419

IUPAC2-[1-[2-(2,4-dichlorophenyl)-2-oxoethyl]cyclohexyl]acetic acid
SMILESO=C(O)CC1(CC(=O)c2ccc(Cl)cc2Cl)CCCCC1
InChIInChI=1S/C16H18Cl2O3/c17-11-4-5-12(13(18)8-11)14(19)9-16(10-15(20)21)6-2-1-3-7-16/h4-5,8H,1-3,6-7,9-10H2,(H,20,21)
InChIKeyYPBQYSRWLLIECD-UHFFFAOYSA-N
MW329.22 g/mol
LogP4.99
Rot. Bonds5

About 2-[1-[2-(2,4-dichlorophenyl)-2-oxoethyl]cyclohexyl]acetic acid

2-[1-[2-(2,4-dichlorophenyl)-2-oxoethyl]cyclohexyl]acetic acid (PubChem CID 63496419) has the molecular formula C16H18Cl2O3 and a molecular weight of 329.22 g/mol. Its IUPAC name is 2-[1-[2-(2,4-dichlorophenyl)-2-oxoethyl]cyclohexyl]acetic acid.

Molecular Properties

Compound Name2-[1-[2-(2,4-dichlorophenyl)-2-oxoethyl]cyclohexyl]acetic acid
PubChem CID63496419
Molecular FormulaC16H18Cl2O3
Molecular Weight329.22 g/mol
Exact Mass328.06
IUPAC Name2-[1-[2-(2,4-dichlorophenyl)-2-oxoethyl]cyclohexyl]acetic acid
SMILESO=C(O)CC1(CC(=O)c2ccc(Cl)cc2Cl)CCCCC1
InChIInChI=1S/C16H18Cl2O3/c17-11-4-5-12(13(18)8-11)14(19)9-16(10-15(20)21)6-2-1-3-7-16/h4-5,8H,1-3,6-7,9-10H2,(H,20,21)
InChIKeyYPBQYSRWLLIECD-UHFFFAOYSA-N
XLogP4.99
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500329.22
LogP ≤ 54.99
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-[1-[2-(2,4-dichlorophenyl)-2-oxoethyl]cyclohexyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[1-[2-(2,4-dichlorophenyl)-2-oxoethyl]cyclohexyl]acetic acid?
The IUPAC name of 2-[1-[2-(2,4-dichlorophenyl)-2-oxoethyl]cyclohexyl]acetic acid (CID 63496419) is 2-[1-[2-(2,4-dichlorophenyl)-2-oxoethyl]cyclohexyl]acetic acid.
What is the SMILES notation for 2-[1-[2-(2,4-dichlorophenyl)-2-oxoethyl]cyclohexyl]acetic acid?
The canonical SMILES for 2-[1-[2-(2,4-dichlorophenyl)-2-oxoethyl]cyclohexyl]acetic acid is O=C(O)CC1(CC(=O)c2ccc(Cl)cc2Cl)CCCCC1.
What is the InChIKey of 2-[1-[2-(2,4-dichlorophenyl)-2-oxoethyl]cyclohexyl]acetic acid?
The InChIKey is YPBQYSRWLLIECD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18Cl2O3/c17-11-4-5-12(13(18)8-11)14(19)9-16(10-15(20)21)6-2-1-3-7-16/h4-5,8H,1-3,6-7,9-10H2,(H,20,21).
What are the key properties of 2-[1-[2-(2,4-dichlorophenyl)-2-oxoethyl]cyclohexyl]acetic acid?
2-[1-[2-(2,4-dichlorophenyl)-2-oxoethyl]cyclohexyl]acetic acid has a molecular weight of 329.22 g/mol, XLogP of 4.99, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[2-(2,4-dichlorophenyl)-2-oxoethyl]cyclohexyl]acetic acid is sourced from PubChem (CID 63496419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).