C13H14BrClO3S — CID 80530829
2-[1-[2-(5-bromo-4-chlorothiophen-2-yl)-2-oxoethyl]cyclopentyl]acetic acid (PubChem CID 80530829) has the molecular formula C13H14BrClO3S and a molecular weight of 365.68 g/mol. Its IUPAC name is 2-[1-[2-(5-bromo-4-chlorothiophen-2-yl)-2-oxoethyl]cyclopentyl]acetic acid.
| Compound Name | 2-[1-[2-(5-bromo-4-chlorothiophen-2-yl)-2-oxoethyl]cyclopentyl]acetic acid |
|---|---|
| PubChem CID | 80530829 |
| Molecular Formula | C13H14BrClO3S |
| Molecular Weight | 365.68 g/mol |
| Exact Mass | 363.95 |
| IUPAC Name | 2-[1-[2-(5-bromo-4-chlorothiophen-2-yl)-2-oxoethyl]cyclopentyl]acetic acid |
| SMILES | O=C(O)CC1(CC(=O)c2cc(Cl)c(Br)s2)CCCC1 |
| InChI | InChI=1S/C13H14BrClO3S/c14-12-8(15)5-10(19-12)9(16)6-13(7-11(17)18)3-1-2-4-13/h5H,1-4,6-7H2,(H,17,18) |
| InChIKey | BSWGXTTVKGXUMK-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.68 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |