C14H18BrClO2S — CID 80532221
2-[1-[2-(5-bromo-4-chlorothiophen-2-yl)ethyl]cyclohexyl]acetic acid (PubChem CID 80532221) has the molecular formula C14H18BrClO2S and a molecular weight of 365.72 g/mol. Its IUPAC name is 2-[1-[2-(5-bromo-4-chlorothiophen-2-yl)ethyl]cyclohexyl]acetic acid.
| Compound Name | 2-[1-[2-(5-bromo-4-chlorothiophen-2-yl)ethyl]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 80532221 |
| Molecular Formula | C14H18BrClO2S |
| Molecular Weight | 365.72 g/mol |
| Exact Mass | 363.99 |
| IUPAC Name | 2-[1-[2-(5-bromo-4-chlorothiophen-2-yl)ethyl]cyclohexyl]acetic acid |
| SMILES | O=C(O)CC1(CCc2cc(Cl)c(Br)s2)CCCCC1 |
| InChI | InChI=1S/C14H18BrClO2S/c15-13-11(16)8-10(19-13)4-7-14(9-12(17)18)5-2-1-3-6-14/h8H,1-7,9H2,(H,17,18) |
| InChIKey | HAHOGMVFLGKTHO-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.72 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |