2-[1-[2-(3,4-dichlorophenyl)ethyl]cyclohexyl]acetic acid

C16H20Cl2O2 — CID 43804838

IUPAC2-[1-[2-(3,4-dichlorophenyl)ethyl]cyclohexyl]acetic acid
SMILESO=C(O)CC1(CCc2ccc(Cl)c(Cl)c2)CCCCC1
InChIInChI=1S/C16H20Cl2O2/c17-13-5-4-12(10-14(13)18)6-9-16(11-15(19)20)7-2-1-3-8-16/h4-5,10H,1-3,6-9,11H2,(H,19,20)
InChIKeyJLDWMYGKBKRILT-UHFFFAOYSA-N
MW315.24 g/mol
LogP5.35
Rot. Bonds5

About 2-[1-[2-(3,4-dichlorophenyl)ethyl]cyclohexyl]acetic acid

2-[1-[2-(3,4-dichlorophenyl)ethyl]cyclohexyl]acetic acid (PubChem CID 43804838) has the molecular formula C16H20Cl2O2 and a molecular weight of 315.24 g/mol. Its IUPAC name is 2-[1-[2-(3,4-dichlorophenyl)ethyl]cyclohexyl]acetic acid.

Molecular Properties

Compound Name2-[1-[2-(3,4-dichlorophenyl)ethyl]cyclohexyl]acetic acid
PubChem CID43804838
Molecular FormulaC16H20Cl2O2
Molecular Weight315.24 g/mol
Exact Mass314.08
IUPAC Name2-[1-[2-(3,4-dichlorophenyl)ethyl]cyclohexyl]acetic acid
SMILESO=C(O)CC1(CCc2ccc(Cl)c(Cl)c2)CCCCC1
InChIInChI=1S/C16H20Cl2O2/c17-13-5-4-12(10-14(13)18)6-9-16(11-15(19)20)7-2-1-3-8-16/h4-5,10H,1-3,6-9,11H2,(H,19,20)
InChIKeyJLDWMYGKBKRILT-UHFFFAOYSA-N
XLogP5.35
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500315.24
LogP ≤ 55.35
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 2-[1-[2-(3,4-dichlorophenyl)ethyl]cyclohexyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[1-[2-(3,4-dichlorophenyl)ethyl]cyclohexyl]acetic acid?
The IUPAC name of 2-[1-[2-(3,4-dichlorophenyl)ethyl]cyclohexyl]acetic acid (CID 43804838) is 2-[1-[2-(3,4-dichlorophenyl)ethyl]cyclohexyl]acetic acid.
What is the SMILES notation for 2-[1-[2-(3,4-dichlorophenyl)ethyl]cyclohexyl]acetic acid?
The canonical SMILES for 2-[1-[2-(3,4-dichlorophenyl)ethyl]cyclohexyl]acetic acid is O=C(O)CC1(CCc2ccc(Cl)c(Cl)c2)CCCCC1.
What is the InChIKey of 2-[1-[2-(3,4-dichlorophenyl)ethyl]cyclohexyl]acetic acid?
The InChIKey is JLDWMYGKBKRILT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20Cl2O2/c17-13-5-4-12(10-14(13)18)6-9-16(11-15(19)20)7-2-1-3-8-16/h4-5,10H,1-3,6-9,11H2,(H,19,20).
What are the key properties of 2-[1-[2-(3,4-dichlorophenyl)ethyl]cyclohexyl]acetic acid?
2-[1-[2-(3,4-dichlorophenyl)ethyl]cyclohexyl]acetic acid has a molecular weight of 315.24 g/mol, XLogP of 5.35, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[2-(3,4-dichlorophenyl)ethyl]cyclohexyl]acetic acid is sourced from PubChem (CID 43804838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).