C16H20Cl2O2 — CID 43804838
2-[1-[2-(3,4-dichlorophenyl)ethyl]cyclohexyl]acetic acid (PubChem CID 43804838) has the molecular formula C16H20Cl2O2 and a molecular weight of 315.24 g/mol. Its IUPAC name is 2-[1-[2-(3,4-dichlorophenyl)ethyl]cyclohexyl]acetic acid.
| Compound Name | 2-[1-[2-(3,4-dichlorophenyl)ethyl]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 43804838 |
| Molecular Formula | C16H20Cl2O2 |
| Molecular Weight | 315.24 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 2-[1-[2-(3,4-dichlorophenyl)ethyl]cyclohexyl]acetic acid |
| SMILES | O=C(O)CC1(CCc2ccc(Cl)c(Cl)c2)CCCCC1 |
| InChI | InChI=1S/C16H20Cl2O2/c17-13-5-4-12(10-14(13)18)6-9-16(11-15(19)20)7-2-1-3-8-16/h4-5,10H,1-3,6-9,11H2,(H,19,20) |
| InChIKey | JLDWMYGKBKRILT-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.24 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |