C14H19Cl2N — CID 63522504
[1-[(3,4-dichlorophenyl)methyl]cyclohexyl]methanamine (PubChem CID 63522504) has the molecular formula C14H19Cl2N and a molecular weight of 272.22 g/mol. Its IUPAC name is [1-[(3,4-dichlorophenyl)methyl]cyclohexyl]methanamine.
| Compound Name | [1-[(3,4-dichlorophenyl)methyl]cyclohexyl]methanamine |
|---|---|
| PubChem CID | 63522504 |
| Molecular Formula | C14H19Cl2N |
| Molecular Weight | 272.22 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | [1-[(3,4-dichlorophenyl)methyl]cyclohexyl]methanamine |
| SMILES | NCC1(Cc2ccc(Cl)c(Cl)c2)CCCCC1 |
| InChI | InChI=1S/C14H19Cl2N/c15-12-5-4-11(8-13(12)16)9-14(10-17)6-2-1-3-7-14/h4-5,8H,1-3,6-7,9-10,17H2 |
| InChIKey | MPYLBHCHOBCDAB-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.22 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |