C13H15Cl3O — CID 66035545
4-(chloromethyl)-4-[(3,4-dichlorophenyl)methyl]oxane (PubChem CID 66035545) has the molecular formula C13H15Cl3O and a molecular weight of 293.62 g/mol. Its IUPAC name is 4-(chloromethyl)-4-[(3,4-dichlorophenyl)methyl]oxane.
| Compound Name | 4-(chloromethyl)-4-[(3,4-dichlorophenyl)methyl]oxane |
|---|---|
| PubChem CID | 66035545 |
| Molecular Formula | C13H15Cl3O |
| Molecular Weight | 293.62 g/mol |
| Exact Mass | 292.02 |
| IUPAC Name | 4-(chloromethyl)-4-[(3,4-dichlorophenyl)methyl]oxane |
| SMILES | ClCC1(Cc2ccc(Cl)c(Cl)c2)CCOCC1 |
| InChI | InChI=1S/C13H15Cl3O/c14-9-13(3-5-17-6-4-13)8-10-1-2-11(15)12(16)7-10/h1-2,7H,3-6,8-9H2 |
| InChIKey | ZXBSAOKLZSUQOG-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.62 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|