C15H21Cl2N — CID 79834366
1-[(3,4-dichlorophenyl)methyl]-2,2-dimethylcyclohexan-1-amine (PubChem CID 79834366) has the molecular formula C15H21Cl2N and a molecular weight of 286.25 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-2,2-dimethylcyclohexan-1-amine.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-2,2-dimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 79834366 |
| Molecular Formula | C15H21Cl2N |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-2,2-dimethylcyclohexan-1-amine |
| SMILES | CC1(C)CCCCC1(N)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H21Cl2N/c1-14(2)7-3-4-8-15(14,18)10-11-5-6-12(16)13(17)9-11/h5-6,9H,3-4,7-8,10,18H2,1-2H3 |
| InChIKey | QIZJCGJBCHKRCT-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |