C13H14Cl2O — CID 116538466
3-[(3,4-dichlorophenyl)methyl]-3-methylcyclopentan-1-one (PubChem CID 116538466) has the molecular formula C13H14Cl2O and a molecular weight of 257.16 g/mol. Its IUPAC name is 3-[(3,4-dichlorophenyl)methyl]-3-methylcyclopentan-1-one.
| Compound Name | 3-[(3,4-dichlorophenyl)methyl]-3-methylcyclopentan-1-one |
|---|---|
| PubChem CID | 116538466 |
| Molecular Formula | C13H14Cl2O |
| Molecular Weight | 257.16 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 3-[(3,4-dichlorophenyl)methyl]-3-methylcyclopentan-1-one |
| SMILES | CC1(Cc2ccc(Cl)c(Cl)c2)CCC(=O)C1 |
| InChI | InChI=1S/C13H14Cl2O/c1-13(5-4-10(16)8-13)7-9-2-3-11(14)12(15)6-9/h2-3,6H,4-5,7-8H2,1H3 |
| InChIKey | OMBNCQFXHYTPQE-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.16 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |