C17H21NO3 — CID 61070388
2-[1-[2-(2-oxo-1,3-dihydroindol-5-yl)ethyl]cyclopentyl]acetic acid (PubChem CID 61070388) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is 2-[1-[2-(2-oxo-1,3-dihydroindol-5-yl)ethyl]cyclopentyl]acetic acid.
| Compound Name | 2-[1-[2-(2-oxo-1,3-dihydroindol-5-yl)ethyl]cyclopentyl]acetic acid |
|---|---|
| PubChem CID | 61070388 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 2-[1-[2-(2-oxo-1,3-dihydroindol-5-yl)ethyl]cyclopentyl]acetic acid |
| SMILES | O=C(O)CC1(CCc2ccc3c(c2)CC(=O)N3)CCCC1 |
| InChI | InChI=1S/C17H21NO3/c19-15-10-13-9-12(3-4-14(13)18-15)5-8-17(11-16(20)21)6-1-2-7-17/h3-4,9H,1-2,5-8,10-11H2,(H,18,19)(H,20,21) |
| InChIKey | JTAOYNCEMGFONH-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |