C15H16N2O4 — CID 102710800
2-[1-[(2-oxo-1,3-dihydroindole-5-carbonyl)amino]cyclobutyl]acetic acid (PubChem CID 102710800) has the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. Its IUPAC name is 2-[1-[(2-oxo-1,3-dihydroindole-5-carbonyl)amino]cyclobutyl]acetic acid.
| Compound Name | 2-[1-[(2-oxo-1,3-dihydroindole-5-carbonyl)amino]cyclobutyl]acetic acid |
|---|---|
| PubChem CID | 102710800 |
| Molecular Formula | C15H16N2O4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 2-[1-[(2-oxo-1,3-dihydroindole-5-carbonyl)amino]cyclobutyl]acetic acid |
| SMILES | O=C(O)CC1(NC(=O)c2ccc3c(c2)CC(=O)N3)CCC1 |
| InChI | InChI=1S/C15H16N2O4/c18-12-7-10-6-9(2-3-11(10)16-12)14(21)17-15(4-1-5-15)8-13(19)20/h2-3,6H,1,4-5,7-8H2,(H,16,18)(H,17,21)(H,19,20) |
| InChIKey | VQKPIIXPXIJGPU-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |