C11H12N2O3 — CID 18765684
N-(2-hydroxyethyl)-2-oxo-1,3-dihydroindole-5-carboxamide (PubChem CID 18765684) has the molecular formula C11H12N2O3 and a molecular weight of 220.23 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-2-oxo-1,3-dihydroindole-5-carboxamide.
| Compound Name | N-(2-hydroxyethyl)-2-oxo-1,3-dihydroindole-5-carboxamide |
|---|---|
| PubChem CID | 18765684 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | N-(2-hydroxyethyl)-2-oxo-1,3-dihydroindole-5-carboxamide |
| SMILES | O=C1Cc2cc(C(=O)NCCO)ccc2N1 |
| InChI | InChI=1S/C11H12N2O3/c14-4-3-12-11(16)7-1-2-9-8(5-7)6-10(15)13-9/h1-2,5,14H,3-4,6H2,(H,12,16)(H,13,15) |
| InChIKey | YFEDUUGLCSPNCI-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |