C12H12N2O4 — CID 83724913
methyl 2-[(2-oxo-1,3-dihydroindole-5-carbonyl)amino]acetate (PubChem CID 83724913) has the molecular formula C12H12N2O4 and a molecular weight of 248.24 g/mol. Its IUPAC name is methyl 2-[(2-oxo-1,3-dihydroindole-5-carbonyl)amino]acetate.
| Compound Name | methyl 2-[(2-oxo-1,3-dihydroindole-5-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 83724913 |
| Molecular Formula | C12H12N2O4 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | methyl 2-[(2-oxo-1,3-dihydroindole-5-carbonyl)amino]acetate |
| SMILES | COC(=O)CNC(=O)c1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C12H12N2O4/c1-18-11(16)6-13-12(17)7-2-3-9-8(4-7)5-10(15)14-9/h2-4H,5-6H2,1H3,(H,13,17)(H,14,15) |
| InChIKey | XDGQLVRCCLCJLQ-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |