C15H20N2O2 — CID 108784631
N-hexyl-2-oxo-1,3-dihydroindole-5-carboxamide (PubChem CID 108784631) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is N-hexyl-2-oxo-1,3-dihydroindole-5-carboxamide.
| Compound Name | N-hexyl-2-oxo-1,3-dihydroindole-5-carboxamide |
|---|---|
| PubChem CID | 108784631 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | N-hexyl-2-oxo-1,3-dihydroindole-5-carboxamide |
| SMILES | CCCCCCNC(=O)c1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C15H20N2O2/c1-2-3-4-5-8-16-15(19)11-6-7-13-12(9-11)10-14(18)17-13/h6-7,9H,2-5,8,10H2,1H3,(H,16,19)(H,17,18) |
| InChIKey | KGAHVDCOXWHDQZ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|