C14H15N5O2 — CID 103711180
2-oxo-N-[3-(1H-1,2,4-triazol-5-yl)propyl]-1,3-dihydroindole-5-carboxamide (PubChem CID 103711180) has the molecular formula C14H15N5O2 and a molecular weight of 285.31 g/mol. Its IUPAC name is 2-oxo-N-[3-(1H-1,2,4-triazol-5-yl)propyl]-1,3-dihydroindole-5-carboxamide.
| Compound Name | 2-oxo-N-[3-(1H-1,2,4-triazol-5-yl)propyl]-1,3-dihydroindole-5-carboxamide |
|---|---|
| PubChem CID | 103711180 |
| Molecular Formula | C14H15N5O2 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 2-oxo-N-[3-(1H-1,2,4-triazol-5-yl)propyl]-1,3-dihydroindole-5-carboxamide |
| SMILES | O=C1Cc2cc(C(=O)NCCCc3ncn[nH]3)ccc2N1 |
| InChI | InChI=1S/C14H15N5O2/c20-13-7-10-6-9(3-4-11(10)18-13)14(21)15-5-1-2-12-16-8-17-19-12/h3-4,6,8H,1-2,5,7H2,(H,15,21)(H,18,20)(H,16,17,19) |
| InChIKey | BJPVJARGXUFDQQ-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|