C15H19N3O2 — CID 102711522
2-oxo-N-(2-pyrrolidin-3-ylethyl)-1,3-dihydroindole-5-carboxamide (PubChem CID 102711522) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 2-oxo-N-(2-pyrrolidin-3-ylethyl)-1,3-dihydroindole-5-carboxamide.
| Compound Name | 2-oxo-N-(2-pyrrolidin-3-ylethyl)-1,3-dihydroindole-5-carboxamide |
|---|---|
| PubChem CID | 102711522 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 2-oxo-N-(2-pyrrolidin-3-ylethyl)-1,3-dihydroindole-5-carboxamide |
| SMILES | O=C1Cc2cc(C(=O)NCCC3CCNC3)ccc2N1 |
| InChI | InChI=1S/C15H19N3O2/c19-14-8-12-7-11(1-2-13(12)18-14)15(20)17-6-4-10-3-5-16-9-10/h1-2,7,10,16H,3-6,8-9H2,(H,17,20)(H,18,19) |
| InChIKey | MGTJLYSTGPJFOU-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |