C14H17N3O2 — CID 102711516
2-oxo-N-piperidin-3-yl-1,3-dihydroindole-5-carboxamide (PubChem CID 102711516) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is 2-oxo-N-piperidin-3-yl-1,3-dihydroindole-5-carboxamide.
| Compound Name | 2-oxo-N-piperidin-3-yl-1,3-dihydroindole-5-carboxamide |
|---|---|
| PubChem CID | 102711516 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 2-oxo-N-piperidin-3-yl-1,3-dihydroindole-5-carboxamide |
| SMILES | O=C1Cc2cc(C(=O)NC3CCCNC3)ccc2N1 |
| InChI | InChI=1S/C14H17N3O2/c18-13-7-10-6-9(3-4-12(10)17-13)14(19)16-11-2-1-5-15-8-11/h3-4,6,11,15H,1-2,5,7-8H2,(H,16,19)(H,17,18) |
| InChIKey | RMLUFOKKFKROLK-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |