C12H16FN3O — CID 89423886
4-amino-3-fluoro-N-[(3R)-piperidin-3-yl]benzamide (PubChem CID 89423886) has the molecular formula C12H16FN3O and a molecular weight of 237.28 g/mol. Its IUPAC name is 4-amino-3-fluoro-N-[(3R)-piperidin-3-yl]benzamide.
| Compound Name | 4-amino-3-fluoro-N-[(3R)-piperidin-3-yl]benzamide |
|---|---|
| PubChem CID | 89423886 |
| Molecular Formula | C12H16FN3O |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 4-amino-3-fluoro-N-[(3R)-piperidin-3-yl]benzamide |
| SMILES | Nc1ccc(C(=O)N[C@@H]2CCCNC2)cc1F |
| InChI | InChI=1S/C12H16FN3O/c13-10-6-8(3-4-11(10)14)12(17)16-9-2-1-5-15-7-9/h3-4,6,9,15H,1-2,5,7,14H2,(H,16,17)/t9-/m1/s1 |
| InChIKey | RTPYGXXCXNLHIL-SECBINFHSA-N |
| XLogP | 0.89 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|