C12H14ClF3N2O — CID 119429053
3,4,5-trifluoro-N-piperidin-3-ylbenzamide;hydrochloride (PubChem CID 119429053) has the molecular formula C12H14ClF3N2O and a molecular weight of 294.70 g/mol. Its IUPAC name is 3,4,5-trifluoro-N-piperidin-3-ylbenzamide;hydrochloride.
| Compound Name | 3,4,5-trifluoro-N-piperidin-3-ylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 119429053 |
| Molecular Formula | C12H14ClF3N2O |
| Molecular Weight | 294.70 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 3,4,5-trifluoro-N-piperidin-3-ylbenzamide;hydrochloride |
| SMILES | Cl.O=C(NC1CCCNC1)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C12H13F3N2O.ClH/c13-9-4-7(5-10(14)11(9)15)12(18)17-8-2-1-3-16-6-8;/h4-5,8,16H,1-3,6H2,(H,17,18);1H |
| InChIKey | ONECGTGQLGIEIV-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.70 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|