C17H20N2O3 — CID 110344793
N-cyclopentyl-4-oxo-4-(2-oxo-1,3-dihydroindol-5-yl)butanamide (PubChem CID 110344793) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is N-cyclopentyl-4-oxo-4-(2-oxo-1,3-dihydroindol-5-yl)butanamide.
| Compound Name | N-cyclopentyl-4-oxo-4-(2-oxo-1,3-dihydroindol-5-yl)butanamide |
|---|---|
| PubChem CID | 110344793 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | N-cyclopentyl-4-oxo-4-(2-oxo-1,3-dihydroindol-5-yl)butanamide |
| SMILES | O=C1Cc2cc(C(=O)CCC(=O)NC3CCCC3)ccc2N1 |
| InChI | InChI=1S/C17H20N2O3/c20-15(7-8-16(21)18-13-3-1-2-4-13)11-5-6-14-12(9-11)10-17(22)19-14/h5-6,9,13H,1-4,7-8,10H2,(H,18,21)(H,19,22) |
| InChIKey | CHVOXTQMVKDKMX-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |