C13H14N2O2S — CID 103708614
2-oxo-N-(thiolan-3-yl)-1,3-dihydroindole-5-carboxamide (PubChem CID 103708614) has the molecular formula C13H14N2O2S and a molecular weight of 262.33 g/mol. Its IUPAC name is 2-oxo-N-(thiolan-3-yl)-1,3-dihydroindole-5-carboxamide.
| Compound Name | 2-oxo-N-(thiolan-3-yl)-1,3-dihydroindole-5-carboxamide |
|---|---|
| PubChem CID | 103708614 |
| Molecular Formula | C13H14N2O2S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 2-oxo-N-(thiolan-3-yl)-1,3-dihydroindole-5-carboxamide |
| SMILES | O=C1Cc2cc(C(=O)NC3CCSC3)ccc2N1 |
| InChI | InChI=1S/C13H14N2O2S/c16-12-6-9-5-8(1-2-11(9)15-12)13(17)14-10-3-4-18-7-10/h1-2,5,10H,3-4,6-7H2,(H,14,17)(H,15,16) |
| InChIKey | JYURGJTVNVHLKJ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |