C14H13N3O4 — CID 102712504
N-(1-methyl-2,5-dioxopyrrolidin-3-yl)-2-oxo-1,3-dihydroindole-5-carboxamide (PubChem CID 102712504) has the molecular formula C14H13N3O4 and a molecular weight of 287.27 g/mol. Its IUPAC name is N-(1-methyl-2,5-dioxopyrrolidin-3-yl)-2-oxo-1,3-dihydroindole-5-carboxamide.
| Compound Name | N-(1-methyl-2,5-dioxopyrrolidin-3-yl)-2-oxo-1,3-dihydroindole-5-carboxamide |
|---|---|
| PubChem CID | 102712504 |
| Molecular Formula | C14H13N3O4 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | N-(1-methyl-2,5-dioxopyrrolidin-3-yl)-2-oxo-1,3-dihydroindole-5-carboxamide |
| SMILES | CN1C(=O)CC(NC(=O)c2ccc3c(c2)CC(=O)N3)C1=O |
| InChI | InChI=1S/C14H13N3O4/c1-17-12(19)6-10(14(17)21)16-13(20)7-2-3-9-8(4-7)5-11(18)15-9/h2-4,10H,5-6H2,1H3,(H,15,18)(H,16,20) |
| InChIKey | AMXPZEOBRVEDBA-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|