C12H10BrClN2O3 — CID 81307054
4-bromo-3-chloro-N-(1-methyl-2,5-dioxopyrrolidin-3-yl)benzamide (PubChem CID 81307054) has the molecular formula C12H10BrClN2O3 and a molecular weight of 345.58 g/mol. Its IUPAC name is 4-bromo-3-chloro-N-(1-methyl-2,5-dioxopyrrolidin-3-yl)benzamide.
| Compound Name | 4-bromo-3-chloro-N-(1-methyl-2,5-dioxopyrrolidin-3-yl)benzamide |
|---|---|
| PubChem CID | 81307054 |
| Molecular Formula | C12H10BrClN2O3 |
| Molecular Weight | 345.58 g/mol |
| Exact Mass | 343.96 |
| IUPAC Name | 4-bromo-3-chloro-N-(1-methyl-2,5-dioxopyrrolidin-3-yl)benzamide |
| SMILES | CN1C(=O)CC(NC(=O)c2ccc(Br)c(Cl)c2)C1=O |
| InChI | InChI=1S/C12H10BrClN2O3/c1-16-10(17)5-9(12(16)19)15-11(18)6-2-3-7(13)8(14)4-6/h2-4,9H,5H2,1H3,(H,15,18) |
| InChIKey | NFOBRIYBWCZSJR-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.58 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|