C11H10N2O6 — CID 104607694
5-[(1-methyl-2,5-dioxopyrrolidin-3-yl)carbamoyl]furan-3-carboxylic acid (PubChem CID 104607694) has the molecular formula C11H10N2O6 and a molecular weight of 266.21 g/mol. Its IUPAC name is 5-[(1-methyl-2,5-dioxopyrrolidin-3-yl)carbamoyl]furan-3-carboxylic acid.
| Compound Name | 5-[(1-methyl-2,5-dioxopyrrolidin-3-yl)carbamoyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 104607694 |
| Molecular Formula | C11H10N2O6 |
| Molecular Weight | 266.21 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 5-[(1-methyl-2,5-dioxopyrrolidin-3-yl)carbamoyl]furan-3-carboxylic acid |
| SMILES | CN1C(=O)CC(NC(=O)c2cc(C(=O)O)co2)C1=O |
| InChI | InChI=1S/C11H10N2O6/c1-13-8(14)3-6(10(13)16)12-9(15)7-2-5(4-19-7)11(17)18/h2,4,6H,3H2,1H3,(H,12,15)(H,17,18) |
| InChIKey | ICWPDNRUCNNAAC-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.21 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|