C12H13N3O3 — CID 948119
N'-[(3S)-1-methyl-2,5-dioxopyrrolidin-3-yl]benzohydrazide (PubChem CID 948119) has the molecular formula C12H13N3O3 and a molecular weight of 247.25 g/mol. Its IUPAC name is N'-[(3S)-1-methyl-2,5-dioxopyrrolidin-3-yl]benzohydrazide.
| Compound Name | N'-[(3S)-1-methyl-2,5-dioxopyrrolidin-3-yl]benzohydrazide |
|---|---|
| PubChem CID | 948119 |
| Molecular Formula | C12H13N3O3 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | N'-[(3S)-1-methyl-2,5-dioxopyrrolidin-3-yl]benzohydrazide |
| SMILES | CN1C(=O)C[C@H](NNC(=O)c2ccccc2)C1=O |
| InChI | InChI=1S/C12H13N3O3/c1-15-10(16)7-9(12(15)18)13-14-11(17)8-5-3-2-4-6-8/h2-6,9,13H,7H2,1H3,(H,14,17)/t9-/m0/s1 |
| InChIKey | QRDGOQOISAEZJF-VIFPVBQESA-N |
| XLogP | -0.32 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|