C16H13ClN4O3 — CID 929792
N'-[(3R)-1-(2-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]pyridine-4-carbohydrazide (PubChem CID 929792) has the molecular formula C16H13ClN4O3 and a molecular weight of 344.76 g/mol. Its IUPAC name is N'-[(3R)-1-(2-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]pyridine-4-carbohydrazide.
| Compound Name | N'-[(3R)-1-(2-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]pyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 929792 |
| Molecular Formula | C16H13ClN4O3 |
| Molecular Weight | 344.76 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | N'-[(3R)-1-(2-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]pyridine-4-carbohydrazide |
| SMILES | O=C(NN[C@@H]1CC(=O)N(c2ccccc2Cl)C1=O)c1ccncc1 |
| InChI | InChI=1S/C16H13ClN4O3/c17-11-3-1-2-4-13(11)21-14(22)9-12(16(21)24)19-20-15(23)10-5-7-18-8-6-10/h1-8,12,19H,9H2,(H,20,23)/t12-/m1/s1 |
| InChIKey | HPQOZOACTCGOKJ-GFCCVEGCSA-N |
| XLogP | 1.30 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.76 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|