C16H12F2N4O3 — CID 92693941
N'-[(3S)-1-(3,4-difluorophenyl)-2,5-dioxopyrrolidin-3-yl]pyridine-4-carbohydrazide (PubChem CID 92693941) has the molecular formula C16H12F2N4O3 and a molecular weight of 346.29 g/mol. Its IUPAC name is N'-[(3S)-1-(3,4-difluorophenyl)-2,5-dioxopyrrolidin-3-yl]pyridine-4-carbohydrazide.
| Compound Name | N'-[(3S)-1-(3,4-difluorophenyl)-2,5-dioxopyrrolidin-3-yl]pyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 92693941 |
| Molecular Formula | C16H12F2N4O3 |
| Molecular Weight | 346.29 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | N'-[(3S)-1-(3,4-difluorophenyl)-2,5-dioxopyrrolidin-3-yl]pyridine-4-carbohydrazide |
| SMILES | O=C(NN[C@H]1CC(=O)N(c2ccc(F)c(F)c2)C1=O)c1ccncc1 |
| InChI | InChI=1S/C16H12F2N4O3/c17-11-2-1-10(7-12(11)18)22-14(23)8-13(16(22)25)20-21-15(24)9-3-5-19-6-4-9/h1-7,13,20H,8H2,(H,21,24)/t13-/m0/s1 |
| InChIKey | DQZJFIPJBRYXJJ-ZDUSSCGKSA-N |
| XLogP | 0.93 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.29 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|