C18H14N3O6- — CID 2447455
4-[(3R)-3-[2-(4-hydroxybenzoyl)hydrazinyl]-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 2447455) has the molecular formula C18H14N3O6- and a molecular weight of 368.33 g/mol. Its IUPAC name is 4-[(3R)-3-[2-(4-hydroxybenzoyl)hydrazinyl]-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | 4-[(3R)-3-[2-(4-hydroxybenzoyl)hydrazinyl]-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 2447455 |
| Molecular Formula | C18H14N3O6- |
| Molecular Weight | 368.33 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 4-[(3R)-3-[2-(4-hydroxybenzoyl)hydrazinyl]-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | O=C([O-])c1ccc(N2C(=O)C[C@@H](NNC(=O)c3ccc(O)cc3)C2=O)cc1 |
| InChI | InChI=1S/C18H15N3O6/c22-13-7-3-10(4-8-13)16(24)20-19-14-9-15(23)21(17(14)25)12-5-1-11(2-6-12)18(26)27/h1-8,14,19,22H,9H2,(H,20,24)(H,26,27)/p-1/t14-/m1/s1 |
| InChIKey | CDOVXEIMYJUVRI-CQSZACIVSA-M |
| XLogP | -0.68 |
| TPSA | 138.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.33 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|