C18H17N3O5 — CID 1213098
2-hydroxy-N'-[(3R)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]benzohydrazide (PubChem CID 1213098) has the molecular formula C18H17N3O5 and a molecular weight of 355.35 g/mol. Its IUPAC name is 2-hydroxy-N'-[(3R)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]benzohydrazide.
| Compound Name | 2-hydroxy-N'-[(3R)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]benzohydrazide |
|---|---|
| PubChem CID | 1213098 |
| Molecular Formula | C18H17N3O5 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 2-hydroxy-N'-[(3R)-1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]benzohydrazide |
| SMILES | COc1ccc(N2C(=O)C[C@@H](NNC(=O)c3ccccc3O)C2=O)cc1 |
| InChI | InChI=1S/C18H17N3O5/c1-26-12-8-6-11(7-9-12)21-16(23)10-14(18(21)25)19-20-17(24)13-4-2-3-5-15(13)22/h2-9,14,19,22H,10H2,1H3,(H,20,24)/t14-/m1/s1 |
| InChIKey | JPYTVFQNYQYHSJ-CQSZACIVSA-N |
| XLogP | 0.97 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|